2,2-di(pyrazol-1-yl)ethanamine

  • InChI=1S/C8H11N5/c9-7-8(12-5-1-3-10-12)13-6-2-4-11-13/h1-6,8H,7,9H2

Fink, Fabian

chemotion.net (2020)
Dataset

Identifikationsnummern